C11H19ClN2O3S — CID 22157092
5-(4-aminobutyl)-2-methoxybenzenesulfonamide;hydrochloride (PubChem CID 22157092) has the molecular formula C11H19ClN2O3S and a molecular weight of 294.80 g/mol. Its IUPAC name is 5-(4-aminobutyl)-2-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | 5-(4-aminobutyl)-2-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22157092 |
| Molecular Formula | C11H19ClN2O3S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-(4-aminobutyl)-2-methoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(CCCCN)cc1S(N)(=O)=O.Cl |
| InChI | InChI=1S/C11H18N2O3S.ClH/c1-16-10-6-5-9(4-2-3-7-12)8-11(10)17(13,14)15;/h5-6,8H,2-4,7,12H2,1H3,(H2,13,14,15);1H |
| InChIKey | JKYXTTZVBRKYDW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|