C10H14N2O7S2 — CID 86597049
N-tert-butyl-1-(2,5-disulfo-3-pyridinyl)methanimine oxide (PubChem CID 86597049) has the molecular formula C10H14N2O7S2 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-tert-butyl-1-(2,5-disulfo-3-pyridinyl)methanimine oxide.
| Compound Name | N-tert-butyl-1-(2,5-disulfo-3-pyridinyl)methanimine oxide |
|---|---|
| PubChem CID | 86597049 |
| Molecular Formula | C10H14N2O7S2 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-tert-butyl-1-(2,5-disulfo-3-pyridinyl)methanimine oxide |
| SMILES | CC(C)(C)[N+]([O-])=Cc1cc(S(=O)(=O)O)cnc1S(=O)(=O)O |
| InChI | InChI=1S/C10H14N2O7S2/c1-10(2,3)12(13)6-7-4-8(20(14,15)16)5-11-9(7)21(17,18)19/h4-6H,1-3H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | IJHMDZUARHRRMC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 147.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|