azane;2-ethenyl-4-methylbenzenesulfonic acid

C9H13NO3S — CID 173319527

IUPACazane;2-ethenyl-4-methylbenzenesulfonic acid
SMILESC=Cc1cc(C)ccc1S(=O)(=O)O.N
InChIInChI=1S/C9H10O3S.H3N/c1-3-8-6-7(2)4-5-9(8)13(10,11)12;/h3-6H,1H2,2H3,(H,10,11,12);1H3
InChIKeyBCVDIOHAJKSKCM-UHFFFAOYSA-N
MW215.27 g/mol
LogP2.05
Rot. Bonds2

About azane;2-ethenyl-4-methylbenzenesulfonic acid

azane;2-ethenyl-4-methylbenzenesulfonic acid (PubChem CID 173319527) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is azane;2-ethenyl-4-methylbenzenesulfonic acid.

Molecular Properties

Compound Nameazane;2-ethenyl-4-methylbenzenesulfonic acid
PubChem CID173319527
Molecular FormulaC9H13NO3S
Molecular Weight215.27 g/mol
Exact Mass215.06
IUPAC Nameazane;2-ethenyl-4-methylbenzenesulfonic acid
SMILESC=Cc1cc(C)ccc1S(=O)(=O)O.N
InChIInChI=1S/C9H10O3S.H3N/c1-3-8-6-7(2)4-5-9(8)13(10,11)12;/h3-6H,1H2,2H3,(H,10,11,12);1H3
InChIKeyBCVDIOHAJKSKCM-UHFFFAOYSA-N
XLogP2.05
TPSA89.37 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.27
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze azane;2-ethenyl-4-methylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-ethenyl-4-methylbenzenesulfonic acid?
The IUPAC name of azane;2-ethenyl-4-methylbenzenesulfonic acid (CID 173319527) is azane;2-ethenyl-4-methylbenzenesulfonic acid.
What is the SMILES notation for azane;2-ethenyl-4-methylbenzenesulfonic acid?
The canonical SMILES for azane;2-ethenyl-4-methylbenzenesulfonic acid is C=Cc1cc(C)ccc1S(=O)(=O)O.N.
What is the InChIKey of azane;2-ethenyl-4-methylbenzenesulfonic acid?
The InChIKey is BCVDIOHAJKSKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S.H3N/c1-3-8-6-7(2)4-5-9(8)13(10,11)12;/h3-6H,1H2,2H3,(H,10,11,12);1H3.
What are the key properties of azane;2-ethenyl-4-methylbenzenesulfonic acid?
azane;2-ethenyl-4-methylbenzenesulfonic acid has a molecular weight of 215.27 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-ethenyl-4-methylbenzenesulfonic acid is sourced from PubChem (CID 173319527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).