About 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid
3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid (PubChem CID 174539210) has the molecular formula C14H20O5S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid.
Molecular Properties
| Compound Name | 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid |
| PubChem CID | 174539210 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid |
| SMILES | C=CC(C)OC(C)C=C.O=S(=O)(O)c1ccccc1O |
| InChI | InChI=1S/C8H14O.C6H6O4S/c1-5-7(3)9-8(4)6-2;7-5-3-1-2-4-6(5)11(8,9)10/h5-8H,1-2H2,3-4H3;1-4,7H,(H,8,9,10) |
| InChIKey | QBBPDOAYMYIKFR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid?
The IUPAC name of 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid (CID 174539210) is 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid.
What is the SMILES notation for 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid?
The canonical SMILES for 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid is C=CC(C)OC(C)C=C.O=S(=O)(O)c1ccccc1O.
What is the InChIKey of 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid?
The InChIKey is QBBPDOAYMYIKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C6H6O4S/c1-5-7(3)9-8(4)6-2;7-5-3-1-2-4-6(5)11(8,9)10/h5-8H,1-2H2,3-4H3;1-4,7H,(H,8,9,10).
What are the key properties of 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid?
3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid has a molecular weight of 300.38 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-en-2-yloxybut-1-ene;2-hydroxybenzenesulfonic acid is sourced from PubChem (CID 174539210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).