About 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline
3-but-3-en-2-yloxybut-1-ene;N-ethylaniline (PubChem CID 66648742) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline.
Molecular Properties
| Compound Name | 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline |
| PubChem CID | 66648742 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline |
| SMILES | C=CC(C)OC(C)C=C.CCNc1ccccc1 |
| InChI | InChI=1S/C8H11N.C8H14O/c1-2-9-8-6-4-3-5-7-8;1-5-7(3)9-8(4)6-2/h3-7,9H,2H2,1H3;5-8H,1-2H2,3-4H3 |
| InChIKey | JQDHCTFWYBQRFR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline?
The IUPAC name of 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline (CID 66648742) is 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline.
What is the SMILES notation for 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline?
The canonical SMILES for 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline is C=CC(C)OC(C)C=C.CCNc1ccccc1.
What is the InChIKey of 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline?
The InChIKey is JQDHCTFWYBQRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C8H14O/c1-2-9-8-6-4-3-5-7-8;1-5-7(3)9-8(4)6-2/h3-7,9H,2H2,1H3;5-8H,1-2H2,3-4H3.
What are the key properties of 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline?
3-but-3-en-2-yloxybut-1-ene;N-ethylaniline has a molecular weight of 247.38 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-en-2-yloxybut-1-ene;N-ethylaniline is sourced from PubChem (CID 66648742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).