About N-ethylaniline;propanedioic acid
N-ethylaniline;propanedioic acid (PubChem CID 67742199) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is N-ethylaniline;propanedioic acid.
Molecular Properties
| Compound Name | N-ethylaniline;propanedioic acid |
| PubChem CID | 67742199 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-ethylaniline;propanedioic acid |
| SMILES | CCNc1ccccc1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C8H11N.C3H4O4/c1-2-9-8-6-4-3-5-7-8;4-2(5)1-3(6)7/h3-7,9H,2H2,1H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | MRCYSIMFHSDLST-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-ethylaniline;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylaniline;propanedioic acid?
The IUPAC name of N-ethylaniline;propanedioic acid (CID 67742199) is N-ethylaniline;propanedioic acid.
What is the SMILES notation for N-ethylaniline;propanedioic acid?
The canonical SMILES for N-ethylaniline;propanedioic acid is CCNc1ccccc1.O=C(O)CC(=O)O.
What is the InChIKey of N-ethylaniline;propanedioic acid?
The InChIKey is MRCYSIMFHSDLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C3H4O4/c1-2-9-8-6-4-3-5-7-8;4-2(5)1-3(6)7/h3-7,9H,2H2,1H3;1H2,(H,4,5)(H,6,7).
What are the key properties of N-ethylaniline;propanedioic acid?
N-ethylaniline;propanedioic acid has a molecular weight of 225.24 g/mol, XLogP of 1.66, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylaniline;propanedioic acid is sourced from PubChem (CID 67742199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).