About N-ethylaniline;4-phenylphenol
N-ethylaniline;4-phenylphenol (PubChem CID 174974376) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is N-ethylaniline;4-phenylphenol.
Molecular Properties
| Compound Name | N-ethylaniline;4-phenylphenol |
| PubChem CID | 174974376 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-ethylaniline;4-phenylphenol |
| SMILES | CCNc1ccccc1.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C8H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-9-8-6-4-3-5-7-8/h1-9,13H;3-7,9H,2H2,1H3 |
| InChIKey | FYIZKBRJMFIYMT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethylaniline;4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylaniline;4-phenylphenol?
The IUPAC name of N-ethylaniline;4-phenylphenol (CID 174974376) is N-ethylaniline;4-phenylphenol.
What is the SMILES notation for N-ethylaniline;4-phenylphenol?
The canonical SMILES for N-ethylaniline;4-phenylphenol is CCNc1ccccc1.Oc1ccc(-c2ccccc2)cc1.
What is the InChIKey of N-ethylaniline;4-phenylphenol?
The InChIKey is FYIZKBRJMFIYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C8H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-9-8-6-4-3-5-7-8/h1-9,13H;3-7,9H,2H2,1H3.
What are the key properties of N-ethylaniline;4-phenylphenol?
N-ethylaniline;4-phenylphenol has a molecular weight of 291.39 g/mol, XLogP of 5.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylaniline;4-phenylphenol is sourced from PubChem (CID 174974376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).