C14H10I2O3S — CID 162699854
5-iodo-2-[(E)-2-(4-iodophenyl)ethenyl]benzenesulfonic acid (PubChem CID 162699854) has the molecular formula C14H10I2O3S and a molecular weight of 512.11 g/mol. Its IUPAC name is 5-iodo-2-[(E)-2-(4-iodophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-iodo-2-[(E)-2-(4-iodophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 162699854 |
| Molecular Formula | C14H10I2O3S |
| Molecular Weight | 512.11 g/mol |
| Exact Mass | 511.84 |
| IUPAC Name | 5-iodo-2-[(E)-2-(4-iodophenyl)ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(I)ccc1/C=C/c1ccc(I)cc1 |
| InChI | InChI=1S/C14H10I2O3S/c15-12-6-2-10(3-7-12)1-4-11-5-8-13(16)9-14(11)20(17,18)19/h1-9H,(H,17,18,19)/b4-1+ |
| InChIKey | INCLJCYNTKIYMG-DAFODLJHSA-N |
| XLogP | 4.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.11 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|