C46H40N8O3S3 — CID 173287310
5-[(4,6-dianilino-1,4-thiazin-2-yl)amino]-2-[2-[4-[(4,6-dianilino-1,4-thiazin-2-yl)amino]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 173287310) has the molecular formula C46H40N8O3S3 and a molecular weight of 849.08 g/mol. Its IUPAC name is 5-[(4,6-dianilino-1,4-thiazin-2-yl)amino]-2-[2-[4-[(4,6-dianilino-1,4-thiazin-2-yl)amino]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4,6-dianilino-1,4-thiazin-2-yl)amino]-2-[2-[4-[(4,6-dianilino-1,4-thiazin-2-yl)amino]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173287310 |
| Molecular Formula | C46H40N8O3S3 |
| Molecular Weight | 849.08 g/mol |
| Exact Mass | 848.24 |
| IUPAC Name | 5-[(4,6-dianilino-1,4-thiazin-2-yl)amino]-2-[2-[4-[(4,6-dianilino-1,4-thiazin-2-yl)amino]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(NC2=CN(Nc3ccccc3)C=C(Nc3ccccc3)S2)ccc1C=Cc1ccc(NC2=CN(Nc3ccccc3)C=C(Nc3ccccc3)S2)cc1 |
| InChI | InChI=1S/C46H40N8O3S3/c55-60(56,57)42-29-41(50-46-33-54(52-40-19-11-4-12-20-40)31-44(59-46)48-37-15-7-2-8-16-37)28-25-35(42)24-21-34-22-26-38(27-23-34)49-45-32-53(51-39-17-9-3-10-18-39)30-43(58-45)47-36-13-5-1-6-14-36/h1-33,47-52H,(H,55,56,57) |
| InChIKey | SPJDQPLPUWMSGY-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.08 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|