C21H19N3O9S2 — CID 171348519
5-(3-oxobutanoylamino)-2-[(E)-2-[4-(3-oxo-1H-pyrazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 171348519) has the molecular formula C21H19N3O9S2 and a molecular weight of 521.53 g/mol. Its IUPAC name is 5-(3-oxobutanoylamino)-2-[(E)-2-[4-(3-oxo-1H-pyrazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(3-oxobutanoylamino)-2-[(E)-2-[4-(3-oxo-1H-pyrazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 171348519 |
| Molecular Formula | C21H19N3O9S2 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 5-(3-oxobutanoylamino)-2-[(E)-2-[4-(3-oxo-1H-pyrazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | CC(=O)CC(=O)Nc1ccc(/C=C/c2ccc(-n3[nH]ccc3=O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H19N3O9S2/c1-13(25)10-20(26)23-16-6-4-14(18(11-16)34(28,29)30)2-3-15-5-7-17(12-19(15)35(31,32)33)24-21(27)8-9-22-24/h2-9,11-12,22H,10H2,1H3,(H,23,26)(H,28,29,30)(H,31,32,33)/b3-2+ |
| InChIKey | VCMNHXXXHOUZNQ-NSCUHMNNSA-N |
| XLogP | 1.75 |
| TPSA | 192.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|