C11H11N3O3Se — CID 60662508
5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid (PubChem CID 60662508) has the molecular formula C11H11N3O3Se and a molecular weight of 312.19 g/mol. Its IUPAC name is 5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid.
| Compound Name | 5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60662508 |
| Molecular Formula | C11H11N3O3Se |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 5-(2,1,3-benzoselenadiazol-4-ylamino)-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C11H11N3O3Se/c15-9(5-2-6-10(16)17)12-7-3-1-4-8-11(7)14-18-13-8/h1,3-4H,2,5-6H2,(H,12,15)(H,16,17) |
| InChIKey | FJXYNLVNEJNIPF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|