C12H16N4OSe — CID 62839530
N-(2,1,3-benzoselenadiazol-4-yl)-3-(ethylamino)butanamide (PubChem CID 62839530) has the molecular formula C12H16N4OSe and a molecular weight of 311.25 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-3-(ethylamino)butanamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-3-(ethylamino)butanamide |
|---|---|
| PubChem CID | 62839530 |
| Molecular Formula | C12H16N4OSe |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-3-(ethylamino)butanamide |
| SMILES | CCNC(C)CC(=O)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C12H16N4OSe/c1-3-13-8(2)7-11(17)14-9-5-4-6-10-12(9)16-18-15-10/h4-6,8,13H,3,7H2,1-2H3,(H,14,17) |
| InChIKey | ZSKJFCDFMHPZCJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|