C11H11ClN4OS2 — CID 4638521
N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-4-chlorobutanamide (PubChem CID 4638521) has the molecular formula C11H11ClN4OS2 and a molecular weight of 314.82 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-4-chlorobutanamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-4-chlorobutanamide |
|---|---|
| PubChem CID | 4638521 |
| Molecular Formula | C11H11ClN4OS2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-4-chlorobutanamide |
| SMILES | O=C(CCCCl)NC(=S)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C11H11ClN4OS2/c12-6-2-5-9(17)14-11(18)13-7-3-1-4-8-10(7)16-19-15-8/h1,3-4H,2,5-6H2,(H2,13,14,17,18) |
| InChIKey | VYAMVSXBJGWJTC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|