C12H8N4O2S2 — CID 739009
N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)furan-2-carboxamide (PubChem CID 739009) has the molecular formula C12H8N4O2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)furan-2-carboxamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 739009 |
| Molecular Formula | C12H8N4O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc2nsnc12)c1ccco1 |
| InChI | InChI=1S/C12H8N4O2S2/c17-11(9-5-2-6-18-9)14-12(19)13-7-3-1-4-8-10(7)16-20-15-8/h1-6H,(H2,13,14,17,19) |
| InChIKey | LRGUILKQEPPSQJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|