C12H7BrN4OSe — CID 62955088
N-(2,1,3-benzoselenadiazol-4-yl)-5-bromopyridine-2-carboxamide (PubChem CID 62955088) has the molecular formula C12H7BrN4OSe and a molecular weight of 382.08 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-5-bromopyridine-2-carboxamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-5-bromopyridine-2-carboxamide |
|---|---|
| PubChem CID | 62955088 |
| Molecular Formula | C12H7BrN4OSe |
| Molecular Weight | 382.08 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-5-bromopyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc2n[se]nc12)c1ccc(Br)cn1 |
| InChI | InChI=1S/C12H7BrN4OSe/c13-7-4-5-10(14-6-7)12(18)15-8-2-1-3-9-11(8)17-19-16-9/h1-6H,(H,15,18) |
| InChIKey | NYRVLHMUTLMAAR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|