C10H11N3SSe — CID 43715883
N-(thiolan-3-yl)-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715883) has the molecular formula C10H11N3SSe and a molecular weight of 284.25 g/mol. Its IUPAC name is N-(thiolan-3-yl)-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-(thiolan-3-yl)-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715883 |
| Molecular Formula | C10H11N3SSe |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | N-(thiolan-3-yl)-2,1,3-benzoselenadiazol-4-amine |
| SMILES | c1cc(NC2CCSC2)c2n[se]nc2c1 |
| InChI | InChI=1S/C10H11N3SSe/c1-2-8(11-7-4-5-14-6-7)10-9(3-1)12-15-13-10/h1-3,7,11H,4-6H2 |
| InChIKey | BYAHUEYVARXJHL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|