C12H14N4S — CID 103065179
3-N-(thiolan-3-yl)quinoxaline-2,3-diamine (PubChem CID 103065179) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-N-(thiolan-3-yl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(thiolan-3-yl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 103065179 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-N-(thiolan-3-yl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1NC1CCSC1 |
| InChI | InChI=1S/C12H14N4S/c13-11-12(14-8-5-6-17-7-8)16-10-4-2-1-3-9(10)15-11/h1-4,8H,5-7H2,(H2,13,15)(H,14,16) |
| InChIKey | LBDDQVPDCPCTPA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |