C8H12N4S — CID 103062457
4-N-(thiolan-3-yl)pyrimidine-4,5-diamine (PubChem CID 103062457) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 4-N-(thiolan-3-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(thiolan-3-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 103062457 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-N-(thiolan-3-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1NC1CCSC1 |
| InChI | InChI=1S/C8H12N4S/c9-7-3-10-5-11-8(7)12-6-1-2-13-4-6/h3,5-6H,1-2,4,9H2,(H,10,11,12) |
| InChIKey | PHCFQVKEUCNVLS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |