C10H12N4S — CID 103062320
5-amino-2-(thiolan-3-ylamino)pyridine-3-carbonitrile (PubChem CID 103062320) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-amino-2-(thiolan-3-ylamino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(thiolan-3-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103062320 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-amino-2-(thiolan-3-ylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(N)cnc1NC1CCSC1 |
| InChI | InChI=1S/C10H12N4S/c11-4-7-3-8(12)5-13-10(7)14-9-1-2-15-6-9/h3,5,9H,1-2,6,12H2,(H,13,14) |
| InChIKey | UJLNLLUKAILXDL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |