C10H10FN3S — CID 129348328
5-fluoro-6-[[(3R)-thiolan-3-yl]amino]pyridine-3-carbonitrile (PubChem CID 129348328) has the molecular formula C10H10FN3S and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-fluoro-6-[[(3R)-thiolan-3-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 5-fluoro-6-[[(3R)-thiolan-3-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129348328 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-fluoro-6-[[(3R)-thiolan-3-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N[C@@H]2CCSC2)c(F)c1 |
| InChI | InChI=1S/C10H10FN3S/c11-9-3-7(4-12)5-13-10(9)14-8-1-2-15-6-8/h3,5,8H,1-2,6H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | HXZQIKIBBNHXCU-MRVPVSSYSA-N |
| XLogP | 2.01 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |