C9H12BrN3S — CID 130703562
5-bromo-2-methyl-N-(thiolan-3-yl)pyrimidin-4-amine (PubChem CID 130703562) has the molecular formula C9H12BrN3S and a molecular weight of 274.19 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(thiolan-3-yl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-methyl-N-(thiolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 130703562 |
| Molecular Formula | C9H12BrN3S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 5-bromo-2-methyl-N-(thiolan-3-yl)pyrimidin-4-amine |
| SMILES | Cc1ncc(Br)c(NC2CCSC2)n1 |
| InChI | InChI=1S/C9H12BrN3S/c1-6-11-4-8(10)9(12-6)13-7-2-3-14-5-7/h4,7H,2-3,5H2,1H3,(H,11,12,13) |
| InChIKey | FEDZUSXSHVAPKV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |