C13H17N3S2 — CID 133485407
2,5-dimethyl-N-(thian-3-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133485407) has the molecular formula C13H17N3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2,5-dimethyl-N-(thian-3-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,5-dimethyl-N-(thian-3-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133485407 |
| Molecular Formula | C13H17N3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2,5-dimethyl-N-(thian-3-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NC2CCCSC2)c2c(C)csc2n1 |
| InChI | InChI=1S/C13H17N3S2/c1-8-6-18-13-11(8)12(14-9(2)15-13)16-10-4-3-5-17-7-10/h6,10H,3-5,7H2,1-2H3,(H,14,15,16) |
| InChIKey | IXCIYQQBVLOLFA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |