C14H21N3S — CID 133461640
2-methyl-N-(thian-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 133461640) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-methyl-N-(thian-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-methyl-N-(thian-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 133461640 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-methyl-N-(thian-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Cc1nc2c(c(NC3CCCSC3)n1)CCCC2 |
| InChI | InChI=1S/C14H21N3S/c1-10-15-13-7-3-2-6-12(13)14(16-10)17-11-5-4-8-18-9-11/h11H,2-9H2,1H3,(H,15,16,17) |
| InChIKey | RVLYZKBYPHXJKY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |