C16H22N6 — CID 133461787
2-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 133461787) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 133461787 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Cc1nc2c(c(NC3CCCn4nc(C)nc43)n1)CCCC2 |
| InChI | InChI=1S/C16H22N6/c1-10-17-13-7-4-3-6-12(13)15(18-10)20-14-8-5-9-22-16(14)19-11(2)21-22/h14H,3-9H2,1-2H3,(H,17,18,20) |
| InChIKey | JTCIRZYMIRJWPB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |