C14H16N6OS — CID 124724879
1-(3-cyano-4-methylthiophen-2-yl)-3-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea (PubChem CID 124724879) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-(3-cyano-4-methylthiophen-2-yl)-3-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea.
| Compound Name | 1-(3-cyano-4-methylthiophen-2-yl)-3-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
|---|---|
| PubChem CID | 124724879 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(3-cyano-4-methylthiophen-2-yl)-3-[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
| SMILES | Cc1nc2n(n1)CCC[C@H]2NC(=O)Nc1scc(C)c1C#N |
| InChI | InChI=1S/C14H16N6OS/c1-8-7-22-13(10(8)6-15)18-14(21)17-11-4-3-5-20-12(11)16-9(2)19-20/h7,11H,3-5H2,1-2H3,(H2,17,18,21)/t11-/m1/s1 |
| InChIKey | AOCBMPWCXBZQHT-LLVKDONJSA-N |
| XLogP | 2.48 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |