C17H27N5O — CID 128633885
1-[2-(cyclopenten-1-yl)-2-methylpropyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea (PubChem CID 128633885) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)-2-methylpropyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea.
| Compound Name | 1-[2-(cyclopenten-1-yl)-2-methylpropyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 128633885 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)-2-methylpropyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| SMILES | Cc1nc2n(n1)CCCC2NC(=O)NCC(C)(C)C1=CCCC1 |
| InChI | InChI=1S/C17H27N5O/c1-12-19-15-14(9-6-10-22(15)21-12)20-16(23)18-11-17(2,3)13-7-4-5-8-13/h7,14H,4-6,8-11H2,1-3H3,(H2,18,20,23) |
| InChIKey | YNDXMYMPLCDNCX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|