C9H14N4S — CID 103065290
2-methyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine (PubChem CID 103065290) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 2-methyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 103065290 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-methyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine |
| SMILES | Cc1nc(N)cc(NC2CCSC2)n1 |
| InChI | InChI=1S/C9H14N4S/c1-6-11-8(10)4-9(12-6)13-7-2-3-14-5-7/h4,7H,2-3,5H2,1H3,(H3,10,11,12,13) |
| InChIKey | NNOVMFIHKSYHLL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |