C12H20N4S — CID 103065273
6-N,5-diethyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine (PubChem CID 103065273) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 6-N,5-diethyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,5-diethyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 103065273 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-N,5-diethyl-4-N-(thiolan-3-yl)pyrimidine-4,6-diamine |
| SMILES | CCNc1ncnc(NC2CCSC2)c1CC |
| InChI | InChI=1S/C12H20N4S/c1-3-10-11(13-4-2)14-8-15-12(10)16-9-5-6-17-7-9/h8-9H,3-7H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | ISLFCFNSNKFYSP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |