C12H15N3Se — CID 64502520
N-(3-methylcyclopentyl)-2,1,3-benzoselenadiazol-4-amine (PubChem CID 64502520) has the molecular formula C12H15N3Se and a molecular weight of 280.23 g/mol. Its IUPAC name is N-(3-methylcyclopentyl)-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-(3-methylcyclopentyl)-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 64502520 |
| Molecular Formula | C12H15N3Se |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-(3-methylcyclopentyl)-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CC1CCC(Nc2cccc3n[se]nc23)C1 |
| InChI | InChI=1S/C12H15N3Se/c1-8-5-6-9(7-8)13-10-3-2-4-11-12(10)15-16-14-11/h2-4,8-9,13H,5-7H2,1H3 |
| InChIKey | INWUQXVUEFCKQG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|