C14H13N3OSe — CID 43715966
4-[1-(2,1,3-benzoselenadiazol-4-ylamino)ethyl]phenol (PubChem CID 43715966) has the molecular formula C14H13N3OSe and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-[1-(2,1,3-benzoselenadiazol-4-ylamino)ethyl]phenol.
| Compound Name | 4-[1-(2,1,3-benzoselenadiazol-4-ylamino)ethyl]phenol |
|---|---|
| PubChem CID | 43715966 |
| Molecular Formula | C14H13N3OSe |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-[1-(2,1,3-benzoselenadiazol-4-ylamino)ethyl]phenol |
| SMILES | CC(Nc1cccc2n[se]nc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H13N3OSe/c1-9(10-5-7-11(18)8-6-10)15-12-3-2-4-13-14(12)17-19-16-13/h2-9,15,18H,1H3 |
| InChIKey | JZSMBQVHCFKNTB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|