C15H15N3Se — CID 43715970
N-[1-(2-methylphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715970) has the molecular formula C15H15N3Se and a molecular weight of 316.27 g/mol. Its IUPAC name is N-[1-(2-methylphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[1-(2-methylphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715970 |
| Molecular Formula | C15H15N3Se |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[1-(2-methylphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | Cc1ccccc1C(C)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C15H15N3Se/c1-10-6-3-4-7-12(10)11(2)16-13-8-5-9-14-15(13)18-19-17-14/h3-9,11,16H,1-2H3 |
| InChIKey | PRWOVZBCOQIUTR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|