C16H17N3Se — CID 43784901
N-(2-methyl-1-phenylpropyl)-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43784901) has the molecular formula C16H17N3Se and a molecular weight of 330.29 g/mol. Its IUPAC name is N-(2-methyl-1-phenylpropyl)-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-(2-methyl-1-phenylpropyl)-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43784901 |
| Molecular Formula | C16H17N3Se |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(2-methyl-1-phenylpropyl)-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CC(C)C(Nc1cccc2n[se]nc12)c1ccccc1 |
| InChI | InChI=1S/C16H17N3Se/c1-11(2)15(12-7-4-3-5-8-12)17-13-9-6-10-14-16(13)19-20-18-14/h3-11,15,17H,1-2H3 |
| InChIKey | XFFKZLBGKKNELG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|