C15H13Cl2N3Se — CID 43784851
N-[1-(3,4-dichlorophenyl)propyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43784851) has the molecular formula C15H13Cl2N3Se and a molecular weight of 385.16 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)propyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)propyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43784851 |
| Molecular Formula | C15H13Cl2N3Se |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)propyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CCC(Nc1cccc2n[se]nc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3Se/c1-2-12(9-6-7-10(16)11(17)8-9)18-13-4-3-5-14-15(13)20-21-19-14/h3-8,12,18H,2H2,1H3 |
| InChIKey | QFYMGAWFUNOHBW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|