C15H15N3OSe — CID 43715909
4-[1-(2,1,3-benzoselenadiazol-4-ylamino)propyl]phenol (PubChem CID 43715909) has the molecular formula C15H15N3OSe and a molecular weight of 332.27 g/mol. Its IUPAC name is 4-[1-(2,1,3-benzoselenadiazol-4-ylamino)propyl]phenol.
| Compound Name | 4-[1-(2,1,3-benzoselenadiazol-4-ylamino)propyl]phenol |
|---|---|
| PubChem CID | 43715909 |
| Molecular Formula | C15H15N3OSe |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-[1-(2,1,3-benzoselenadiazol-4-ylamino)propyl]phenol |
| SMILES | CCC(Nc1cccc2n[se]nc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H15N3OSe/c1-2-12(10-6-8-11(19)9-7-10)16-13-4-3-5-14-15(13)18-20-17-14/h3-9,12,16,19H,2H2,1H3 |
| InChIKey | FIUFYZSTNREYEF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|