C16H17N3OSe — CID 43715912
N-[1-(4-ethoxyphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715912) has the molecular formula C16H17N3OSe and a molecular weight of 346.29 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[1-(4-ethoxyphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715912 |
| Molecular Formula | C16H17N3OSe |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CCOc1ccc(C(C)Nc2cccc3n[se]nc23)cc1 |
| InChI | InChI=1S/C16H17N3OSe/c1-3-20-13-9-7-12(8-10-13)11(2)17-14-5-4-6-15-16(14)19-21-18-15/h4-11,17H,3H2,1-2H3 |
| InChIKey | HHISYHRUXLTQQP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|