C12H12N4SSe — CID 43716043
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43716043) has the molecular formula C12H12N4SSe and a molecular weight of 323.28 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43716043 |
| Molecular Formula | C12H12N4SSe |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | Cc1nc(C(C)Nc2cccc3n[se]nc23)cs1 |
| InChI | InChI=1S/C12H12N4SSe/c1-7(11-6-17-8(2)14-11)13-9-4-3-5-10-12(9)16-18-15-10/h3-7,13H,1-2H3 |
| InChIKey | YOPDRPANRIHDEK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|