C15H14BrN3S — CID 116783492
3-bromo-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]quinolin-8-amine (PubChem CID 116783492) has the molecular formula C15H14BrN3S and a molecular weight of 348.27 g/mol. Its IUPAC name is 3-bromo-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]quinolin-8-amine.
| Compound Name | 3-bromo-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]quinolin-8-amine |
|---|---|
| PubChem CID | 116783492 |
| Molecular Formula | C15H14BrN3S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3-bromo-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]quinolin-8-amine |
| SMILES | Cc1nc(C(C)Nc2cccc3cc(Br)cnc23)cs1 |
| InChI | InChI=1S/C15H14BrN3S/c1-9(14-8-20-10(2)19-14)18-13-5-3-4-11-6-12(16)7-17-15(11)13/h3-9,18H,1-2H3 |
| InChIKey | SLMMGXWYBNLBLI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |