C17H19N3Se — CID 43715911
N-(3-methyl-1-phenylbutyl)-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715911) has the molecular formula C17H19N3Se and a molecular weight of 344.32 g/mol. Its IUPAC name is N-(3-methyl-1-phenylbutyl)-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-(3-methyl-1-phenylbutyl)-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715911 |
| Molecular Formula | C17H19N3Se |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(3-methyl-1-phenylbutyl)-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CC(C)CC(Nc1cccc2n[se]nc12)c1ccccc1 |
| InChI | InChI=1S/C17H19N3Se/c1-12(2)11-16(13-7-4-3-5-8-13)18-14-9-6-10-15-17(14)20-21-19-15/h3-10,12,16,18H,11H2,1-2H3 |
| InChIKey | QZXGDSQVTIHALW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|