C11H15N5O — CID 158648673
9-propan-2-yl-2-(prop-1-en-2-ylamino)-1H-purin-6-one (PubChem CID 158648673) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 9-propan-2-yl-2-(prop-1-en-2-ylamino)-1H-purin-6-one.
| Compound Name | 9-propan-2-yl-2-(prop-1-en-2-ylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 158648673 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 9-propan-2-yl-2-(prop-1-en-2-ylamino)-1H-purin-6-one |
| SMILES | C=C(C)Nc1nc2c(ncn2C(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O/c1-6(2)13-11-14-9-8(10(17)15-11)12-5-16(9)7(3)4/h5,7H,1H2,2-4H3,(H2,13,14,15,17) |
| InChIKey | GOZIAYOQSBSEHI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |