C11H16N4O11P2 — CID 163199209
[(2R,3R,5S)-3,4-dihydroxy-5-[(6-oxo-1H-purin-9-yl)methyl]oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 163199209) has the molecular formula C11H16N4O11P2 and a molecular weight of 442.21 g/mol. Its IUPAC name is [(2R,3R,5S)-3,4-dihydroxy-5-[(6-oxo-1H-purin-9-yl)methyl]oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,5S)-3,4-dihydroxy-5-[(6-oxo-1H-purin-9-yl)methyl]oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163199209 |
| Molecular Formula | C11H16N4O11P2 |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | [(2R,3R,5S)-3,4-dihydroxy-5-[(6-oxo-1H-purin-9-yl)methyl]oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1[nH]cnc2c1ncn2C[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@H](O)C1O |
| InChI | InChI=1S/C11H16N4O11P2/c16-8-5(1-15-4-14-7-10(15)12-3-13-11(7)18)25-6(9(8)17)2-24-28(22,23)26-27(19,20)21/h3-6,8-9,16-17H,1-2H2,(H,22,23)(H,12,13,18)(H2,19,20,21)/t5-,6+,8?,9-/m0/s1 |
| InChIKey | MRJXKBZSHRSQCM-BVNNJOMPSA-N |
| XLogP | -2.16 |
| TPSA | 226.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|