C10H14N5O14P3 — CID 135445733
[[(2S)-2-[(1R)-1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135445733) has the molecular formula C10H14N5O14P3 and a molecular weight of 521.17 g/mol. Its IUPAC name is [[(2S)-2-[(1R)-1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S)-2-[(1R)-1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135445733 |
| Molecular Formula | C10H14N5O14P3 |
| Molecular Weight | 521.17 g/mol |
| Exact Mass | 520.98 |
| IUPAC Name | [[(2S)-2-[(1R)-1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H](C=O)O[C@H](C=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O14P3/c11-10-13-8-7(9(18)14-10)12-4-15(8)6(2-17)27-5(1-16)3-26-31(22,23)29-32(24,25)28-30(19,20)21/h1-2,4-6H,3H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t5-,6-/m1/s1 |
| InChIKey | WLWJABWDNIDWJX-PHDIDXHHSA-N |
| XLogP | -1.67 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|