C10H12N5O8P — CID 137192397
[(2R)-2-[1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropyl] dihydrogen phosphate (PubChem CID 137192397) has the molecular formula C10H12N5O8P and a molecular weight of 361.21 g/mol. Its IUPAC name is [(2R)-2-[1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-[1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 137192397 |
| Molecular Formula | C10H12N5O8P |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [(2R)-2-[1-(2-amino-6-oxo-1H-purin-9-yl)-2-oxoethoxy]-3-oxopropyl] dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2C(C=O)O[C@@H](C=O)COP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N5O8P/c11-10-13-8-7(9(18)14-10)12-4-15(8)6(2-17)23-5(1-16)3-22-24(19,20)21/h1-2,4-6H,3H2,(H2,19,20,21)(H3,11,13,14,18)/t5-,6?/m0/s1 |
| InChIKey | TUZMWYKHGVHBFZ-ZBHICJROSA-N |
| XLogP | -1.91 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|