C22H23N9O3 — CID 135494965
2-amino-9-[1-[1-hydroxy-3-(phenylhydrazinylidene)propan-2-yl]oxy-2-(phenylhydrazinylidene)ethyl]-1H-purin-6-one (PubChem CID 135494965) has the molecular formula C22H23N9O3 and a molecular weight of 461.49 g/mol. Its IUPAC name is 2-amino-9-[1-[1-hydroxy-3-(phenylhydrazinylidene)propan-2-yl]oxy-2-(phenylhydrazinylidene)ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[1-[1-hydroxy-3-(phenylhydrazinylidene)propan-2-yl]oxy-2-(phenylhydrazinylidene)ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135494965 |
| Molecular Formula | C22H23N9O3 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-amino-9-[1-[1-hydroxy-3-(phenylhydrazinylidene)propan-2-yl]oxy-2-(phenylhydrazinylidene)ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C(C=NNc2ccccc2)OC(C=NNc2ccccc2)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C22H23N9O3/c23-22-27-20-19(21(33)28-22)24-14-31(20)18(12-26-30-16-9-5-2-6-10-16)34-17(13-32)11-25-29-15-7-3-1-4-8-15/h1-12,14,17-18,29-30,32H,13H2,(H3,23,27,28,33) |
| InChIKey | BPDYNMZSFHWCRL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 167.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|