C19H31N5O4Si — CID 59283952
2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-tri(propan-2-yl)silyloxypropanal (PubChem CID 59283952) has the molecular formula C19H31N5O4Si and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-tri(propan-2-yl)silyloxypropanal.
| Compound Name | 2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-tri(propan-2-yl)silyloxypropanal |
|---|---|
| PubChem CID | 59283952 |
| Molecular Formula | C19H31N5O4Si |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-tri(propan-2-yl)silyloxypropanal |
| SMILES | CC(C)[Si](OCC(C=O)OC(C=O)n1cnc2c(N)ncnc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H31N5O4Si/c1-12(2)29(13(3)4,14(5)6)27-9-15(7-25)28-16(8-26)24-11-23-17-18(20)21-10-22-19(17)24/h7-8,10-16H,9H2,1-6H3,(H2,20,21,22) |
| InChIKey | OYPXBZVMUFULCA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|