C16H23ClFN5O2Si — CID 11025765
9-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl]-6-chloropurin-2-amine (PubChem CID 11025765) has the molecular formula C16H23ClFN5O2Si and a molecular weight of 399.93 g/mol. Its IUPAC name is 9-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl]-6-chloropurin-2-amine.
| Compound Name | 9-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl]-6-chloropurin-2-amine |
|---|---|
| PubChem CID | 11025765 |
| Molecular Formula | C16H23ClFN5O2Si |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 9-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl]-6-chloropurin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C=C(F)[C@H](n2cnc3c(Cl)nc(N)nc32)O1 |
| InChI | InChI=1S/C16H23ClFN5O2Si/c1-16(2,3)26(4,5)24-7-9-6-10(18)14(25-9)23-8-20-11-12(17)21-15(19)22-13(11)23/h6,8-9,14H,7H2,1-5H3,(H2,19,21,22)/t9-,14+/m0/s1 |
| InChIKey | BGQLLKXRHKVWOZ-LKFCYVNXSA-N |
| XLogP | 3.83 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|