C22H22ClFN4O3 — CID 142419657
N-[7-[(1R,2S,3R,4S)-4-[(4-chlorophenyl)-fluoromethyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide (PubChem CID 142419657) has the molecular formula C22H22ClFN4O3 and a molecular weight of 444.89 g/mol. Its IUPAC name is N-[7-[(1R,2S,3R,4S)-4-[(4-chlorophenyl)-fluoromethyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide.
| Compound Name | N-[7-[(1R,2S,3R,4S)-4-[(4-chlorophenyl)-fluoromethyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 142419657 |
| Molecular Formula | C22H22ClFN4O3 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[7-[(1R,2S,3R,4S)-4-[(4-chlorophenyl)-fluoromethyl]-2,3-dihydroxycyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ncnc2c1ccn2[C@@H]1C[C@H](C(F)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22ClFN4O3/c1-11(2)22(31)27-20-14-7-8-28(21(14)26-10-25-20)16-9-15(18(29)19(16)30)17(24)12-3-5-13(23)6-4-12/h3-8,10,15-19,29-30H,1,9H2,2H3,(H,25,26,27,31)/t15-,16-,17?,18-,19+/m1/s1 |
| InChIKey | QVMSJEYVAYRRNU-SCIMBWJRSA-N |
| XLogP | 3.59 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|