C22H22ClFN4O2 — CID 142419611
N-[7-[3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide (PubChem CID 142419611) has the molecular formula C22H22ClFN4O2 and a molecular weight of 428.90 g/mol. Its IUPAC name is N-[7-[3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide.
| Compound Name | N-[7-[3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 142419611 |
| Molecular Formula | C22H22ClFN4O2 |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[7-[3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]cyclopentyl]pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ncnc2c1ccn2C1CCC(C(O)c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C22H22ClFN4O2/c1-12(2)22(30)27-20-16-7-8-28(21(16)26-11-25-20)15-5-3-13(9-15)19(29)14-4-6-17(23)18(24)10-14/h4,6-8,10-11,13,15,19,29H,1,3,5,9H2,2H3,(H,25,26,27,30) |
| InChIKey | IUGJTNXTFNUPSY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|