C17H17ClFN4O4+ — CID 155706339
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-1-ium-7-yl)-5-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol (PubChem CID 155706339) has the molecular formula C17H17ClFN4O4+ and a molecular weight of 395.80 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-1-ium-7-yl)-5-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-1-ium-7-yl)-5-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 155706339 |
| Molecular Formula | C17H17ClFN4O4+ |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-1-ium-7-yl)-5-[(R)-(3-chloro-4-fluorophenyl)-hydroxymethyl]oxolane-3,4-diol |
| SMILES | Nc1nc[nH+]c2c1ccn2[C@@H]1O[C@H]([C@H](O)c2ccc(F)c(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H16ClFN4O4/c18-9-5-7(1-2-10(9)19)11(24)14-12(25)13(26)17(27-14)23-4-3-8-15(20)21-6-22-16(8)23/h1-6,11-14,17,24-26H,(H2,20,21,22)/p+1/t11-,12+,13-,14-,17-/m1/s1 |
| InChIKey | GNXGZJMASXBQEJ-QFRSUPTLSA-O |
| XLogP | 0.58 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |