C19H20FN3O4 — CID 139519011
(2R,3S,4R,5R)-2-[(4-fluoro-3-methylphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 139519011) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(4-fluoro-3-methylphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(4-fluoro-3-methylphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 139519011 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(4-fluoro-3-methylphenyl)-hydroxymethyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1cc(C(O)[C@H]2O[C@@H](n3ccc4c(C)ncnc43)[C@H](O)[C@@H]2O)ccc1F |
| InChI | InChI=1S/C19H20FN3O4/c1-9-7-11(3-4-13(9)20)14(24)17-15(25)16(26)19(27-17)23-6-5-12-10(2)21-8-22-18(12)23/h3-8,14-17,19,24-26H,1-2H3/t14?,15-,16+,17+,19+/m0/s1 |
| InChIKey | VSMRUEXRQOTXLT-FXNLYBPTSA-N |
| XLogP | 1.54 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |