C18H16F2IN3O4 — CID 122522326
(2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-iodophenyl)-hydroxymethyl]-5-[4-(fluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 122522326) has the molecular formula C18H16F2IN3O4 and a molecular weight of 503.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-iodophenyl)-hydroxymethyl]-5-[4-(fluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-iodophenyl)-hydroxymethyl]-5-[4-(fluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 122522326 |
| Molecular Formula | C18H16F2IN3O4 |
| Molecular Weight | 503.24 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(R)-(4-fluoro-3-iodophenyl)-hydroxymethyl]-5-[4-(fluoromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H]([C@H](O)c2ccc(F)c(I)c2)O[C@H]1n1ccc2c(CF)ncnc21 |
| InChI | InChI=1S/C18H16F2IN3O4/c19-6-12-9-3-4-24(17(9)23-7-22-12)18-15(27)14(26)16(28-18)13(25)8-1-2-10(20)11(21)5-8/h1-5,7,13-16,18,25-27H,6H2/t13-,14+,15-,16-,18-/m1/s1 |
| InChIKey | HYDWEDUBQXZBRZ-ORDFZIBCSA-N |
| XLogP | 2.00 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|